C30H27N3O4S — CID 139824276
(2S)-2-[[(2S)-2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(4-pyrimidin-5-ylphenyl)propanoic acid (PubChem CID 139824276) has the molecular formula C30H27N3O4S and a molecular weight of 525.63 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(4-pyrimidin-5-ylphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(4-pyrimidin-5-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 139824276 |
| Molecular Formula | C30H27N3O4S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | (2S)-2-[[(2S)-2-(benzoylsulfanylmethyl)-3-phenylpropanoyl]amino]-3-(4-pyrimidin-5-ylphenyl)propanoic acid |
| SMILES | O=C(SC[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(-c2cncnc2)cc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C30H27N3O4S/c34-28(25(15-21-7-3-1-4-8-21)19-38-30(37)24-9-5-2-6-10-24)33-27(29(35)36)16-22-11-13-23(14-12-22)26-17-31-20-32-18-26/h1-14,17-18,20,25,27H,15-16,19H2,(H,33,34)(H,35,36)/t25-,27+/m1/s1 |
| InChIKey | GBTHHEIQIOGXKI-VPUSJEBWSA-N |
| XLogP | 4.69 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|