C18H19F3NO4P — CID 100927098
N-[1-dimethoxyphosphoryl-2-[4-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 100927098) has the molecular formula C18H19F3NO4P and a molecular weight of 401.32 g/mol. Its IUPAC name is N-[1-dimethoxyphosphoryl-2-[4-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | N-[1-dimethoxyphosphoryl-2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 100927098 |
| Molecular Formula | C18H19F3NO4P |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[1-dimethoxyphosphoryl-2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | COP(=O)(OC)C(Cc1ccc(C(F)(F)F)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19F3NO4P/c1-25-27(24,26-2)16(22-17(23)14-6-4-3-5-7-14)12-13-8-10-15(11-9-13)18(19,20)21/h3-11,16H,12H2,1-2H3,(H,22,23) |
| InChIKey | OXUFUNZXFLVHFC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|