C18H17F3LiNO3 — CID 174428956
lithium;hydride;[[2-methyl-3-[4-(trifluoromethyl)phenyl]propanoyl]amino] benzoate (PubChem CID 174428956) has the molecular formula C18H17F3LiNO3 and a molecular weight of 359.27 g/mol. Its IUPAC name is lithium;hydride;[[2-methyl-3-[4-(trifluoromethyl)phenyl]propanoyl]amino] benzoate.
| Compound Name | lithium;hydride;[[2-methyl-3-[4-(trifluoromethyl)phenyl]propanoyl]amino] benzoate |
|---|---|
| PubChem CID | 174428956 |
| Molecular Formula | C18H17F3LiNO3 |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | lithium;hydride;[[2-methyl-3-[4-(trifluoromethyl)phenyl]propanoyl]amino] benzoate |
| SMILES | CC(Cc1ccc(C(F)(F)F)cc1)C(=O)NOC(=O)c1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C18H16F3NO3.Li.H/c1-12(11-13-7-9-15(10-8-13)18(19,20)21)16(23)22-25-17(24)14-5-3-2-4-6-14;;/h2-10,12H,11H2,1H3,(H,22,23);;/q;+1;-1 |
| InChIKey | YMHKAIIBNUWQER-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|