C20H22F3NO2 — CID 122037540
(2S)-3-phenyl-2-[4-[4-(trifluoromethyl)phenyl]butan-2-ylamino]propanoic acid (PubChem CID 122037540) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[4-[4-(trifluoromethyl)phenyl]butan-2-ylamino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[4-[4-(trifluoromethyl)phenyl]butan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 122037540 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (2S)-3-phenyl-2-[4-[4-(trifluoromethyl)phenyl]butan-2-ylamino]propanoic acid |
| SMILES | CC(CCc1ccc(C(F)(F)F)cc1)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H22F3NO2/c1-14(7-8-15-9-11-17(12-10-15)20(21,22)23)24-18(19(25)26)13-16-5-3-2-4-6-16/h2-6,9-12,14,18,24H,7-8,13H2,1H3,(H,25,26)/t14?,18-/m0/s1 |
| InChIKey | VSAXTHPYYNGPQM-IBYPIGCZSA-N |
| XLogP | 4.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |