C19H29NO2 — CID 122037642
(2S)-2-(4-cyclohexylbutan-2-ylamino)-3-phenylpropanoic acid (PubChem CID 122037642) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (2S)-2-(4-cyclohexylbutan-2-ylamino)-3-phenylpropanoic acid.
| Compound Name | (2S)-2-(4-cyclohexylbutan-2-ylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 122037642 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (2S)-2-(4-cyclohexylbutan-2-ylamino)-3-phenylpropanoic acid |
| SMILES | CC(CCC1CCCCC1)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H29NO2/c1-15(12-13-16-8-4-2-5-9-16)20-18(19(21)22)14-17-10-6-3-7-11-17/h3,6-7,10-11,15-16,18,20H,2,4-5,8-9,12-14H2,1H3,(H,21,22)/t15?,18-/m0/s1 |
| InChIKey | KHJPYMQQUCIFKD-PKHIMPSTSA-N |
| XLogP | 4.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |