C17H19N2O6P — CID 85367009
N-[1-dimethoxyphosphoryl-2-(4-nitrophenyl)ethyl]benzamide (PubChem CID 85367009) has the molecular formula C17H19N2O6P and a molecular weight of 378.32 g/mol. Its IUPAC name is N-[1-dimethoxyphosphoryl-2-(4-nitrophenyl)ethyl]benzamide.
| Compound Name | N-[1-dimethoxyphosphoryl-2-(4-nitrophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 85367009 |
| Molecular Formula | C17H19N2O6P |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[1-dimethoxyphosphoryl-2-(4-nitrophenyl)ethyl]benzamide |
| SMILES | COP(=O)(OC)C(Cc1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19N2O6P/c1-24-26(23,25-2)16(18-17(20)14-6-4-3-5-7-14)12-13-8-10-15(11-9-13)19(21)22/h3-11,16H,12H2,1-2H3,(H,18,20) |
| InChIKey | PFNOWLFGFIRVOM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|