C17H19ClNO4P — CID 100927094
N-[2-(4-chlorophenyl)-1-dimethoxyphosphorylethyl]benzamide (PubChem CID 100927094) has the molecular formula C17H19ClNO4P and a molecular weight of 367.77 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-1-dimethoxyphosphorylethyl]benzamide.
| Compound Name | N-[2-(4-chlorophenyl)-1-dimethoxyphosphorylethyl]benzamide |
|---|---|
| PubChem CID | 100927094 |
| Molecular Formula | C17H19ClNO4P |
| Molecular Weight | 367.77 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)-1-dimethoxyphosphorylethyl]benzamide |
| SMILES | COP(=O)(OC)C(Cc1ccc(Cl)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19ClNO4P/c1-22-24(21,23-2)16(12-13-8-10-15(18)11-9-13)19-17(20)14-6-4-3-5-7-14/h3-11,16H,12H2,1-2H3,(H,19,20) |
| InChIKey | YVWMTWPFAYITRM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|