C29H25Cl2NO — CID 142818762
N-[(3R)-3,4-bis(4-chlorophenyl)butan-2-yl]-4-phenylbenzamide (PubChem CID 142818762) has the molecular formula C29H25Cl2NO and a molecular weight of 474.43 g/mol. Its IUPAC name is N-[(3R)-3,4-bis(4-chlorophenyl)butan-2-yl]-4-phenylbenzamide.
| Compound Name | N-[(3R)-3,4-bis(4-chlorophenyl)butan-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 142818762 |
| Molecular Formula | C29H25Cl2NO |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-[(3R)-3,4-bis(4-chlorophenyl)butan-2-yl]-4-phenylbenzamide |
| SMILES | CC(NC(=O)c1ccc(-c2ccccc2)cc1)[C@H](Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H25Cl2NO/c1-20(32-29(33)25-11-9-23(10-12-25)22-5-3-2-4-6-22)28(24-13-17-27(31)18-14-24)19-21-7-15-26(30)16-8-21/h2-18,20,28H,19H2,1H3,(H,32,33)/t20?,28-/m0/s1 |
| InChIKey | OQODPAZBLGNLTA-GPIXMLASSA-N |
| XLogP | 7.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |