C28H29Cl2NO2 — CID 23404775
N-[3,4-bis(4-chlorophenyl)butan-2-yl]-5-(2-methylphenyl)-5-oxopentanamide (PubChem CID 23404775) has the molecular formula C28H29Cl2NO2 and a molecular weight of 482.45 g/mol. Its IUPAC name is N-[3,4-bis(4-chlorophenyl)butan-2-yl]-5-(2-methylphenyl)-5-oxopentanamide.
| Compound Name | N-[3,4-bis(4-chlorophenyl)butan-2-yl]-5-(2-methylphenyl)-5-oxopentanamide |
|---|---|
| PubChem CID | 23404775 |
| Molecular Formula | C28H29Cl2NO2 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[3,4-bis(4-chlorophenyl)butan-2-yl]-5-(2-methylphenyl)-5-oxopentanamide |
| SMILES | Cc1ccccc1C(=O)CCCC(=O)NC(C)C(Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H29Cl2NO2/c1-19-6-3-4-7-25(19)27(32)8-5-9-28(33)31-20(2)26(22-12-16-24(30)17-13-22)18-21-10-14-23(29)15-11-21/h3-4,6-7,10-17,20,26H,5,8-9,18H2,1-2H3,(H,31,33) |
| InChIKey | HSRDFWDEKQJQBU-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |