C22H19Cl3N2O — CID 142818729
N-[(2R)-1-amino-2,3-bis(4-chlorophenyl)propyl]-2-chlorobenzamide (PubChem CID 142818729) has the molecular formula C22H19Cl3N2O and a molecular weight of 433.77 g/mol. Its IUPAC name is N-[(2R)-1-amino-2,3-bis(4-chlorophenyl)propyl]-2-chlorobenzamide.
| Compound Name | N-[(2R)-1-amino-2,3-bis(4-chlorophenyl)propyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 142818729 |
| Molecular Formula | C22H19Cl3N2O |
| Molecular Weight | 433.77 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | N-[(2R)-1-amino-2,3-bis(4-chlorophenyl)propyl]-2-chlorobenzamide |
| SMILES | NC(NC(=O)c1ccccc1Cl)[C@H](Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19Cl3N2O/c23-16-9-5-14(6-10-16)13-19(15-7-11-17(24)12-8-15)21(26)27-22(28)18-3-1-2-4-20(18)25/h1-12,19,21H,13,26H2,(H,27,28)/t19-,21?/m1/s1 |
| InChIKey | AWMGDYAQKIOTCW-YMBRHYMPSA-N |
| XLogP | 5.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.77 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|