C26H24Cl2N2OS — CID 22270678
3-(1,3-benzothiazol-2-yl)-N-[3,4-bis(4-chlorophenyl)butan-2-yl]propanamide (PubChem CID 22270678) has the molecular formula C26H24Cl2N2OS and a molecular weight of 483.46 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-[3,4-bis(4-chlorophenyl)butan-2-yl]propanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-[3,4-bis(4-chlorophenyl)butan-2-yl]propanamide |
|---|---|
| PubChem CID | 22270678 |
| Molecular Formula | C26H24Cl2N2OS |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-[3,4-bis(4-chlorophenyl)butan-2-yl]propanamide |
| SMILES | CC(NC(=O)CCc1nc2ccccc2s1)C(Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24Cl2N2OS/c1-17(29-25(31)14-15-26-30-23-4-2-3-5-24(23)32-26)22(19-8-12-21(28)13-9-19)16-18-6-10-20(27)11-7-18/h2-13,17,22H,14-16H2,1H3,(H,29,31) |
| InChIKey | QNXZEICKDUBUFC-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |