C21H25Cl2NO — CID 10237327
N-[3,4-bis(4-chlorophenyl)butan-2-yl]-3-methylbutanamide (PubChem CID 10237327) has the molecular formula C21H25Cl2NO and a molecular weight of 378.34 g/mol. Its IUPAC name is N-[3,4-bis(4-chlorophenyl)butan-2-yl]-3-methylbutanamide.
| Compound Name | N-[3,4-bis(4-chlorophenyl)butan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 10237327 |
| Molecular Formula | C21H25Cl2NO |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[3,4-bis(4-chlorophenyl)butan-2-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(C)C(Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25Cl2NO/c1-14(2)12-21(25)24-15(3)20(17-6-10-19(23)11-7-17)13-16-4-8-18(22)9-5-16/h4-11,14-15,20H,12-13H2,1-3H3,(H,24,25) |
| InChIKey | LSNQPHQDMXLLGX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |