C19H22ClNO — CID 60548268
N-[2-(4-chlorophenyl)-1-phenylethyl]-3-methylbutanamide (PubChem CID 60548268) has the molecular formula C19H22ClNO and a molecular weight of 315.84 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-1-phenylethyl]-3-methylbutanamide.
| Compound Name | N-[2-(4-chlorophenyl)-1-phenylethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 60548268 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[2-(4-chlorophenyl)-1-phenylethyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(Cc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H22ClNO/c1-14(2)12-19(22)21-18(16-6-4-3-5-7-16)13-15-8-10-17(20)11-9-15/h3-11,14,18H,12-13H2,1-2H3,(H,21,22) |
| InChIKey | NRSQQQARWYYQOC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |