C22H21ClN2O3S — CID 56552713
N-[2-(4-chlorophenyl)-1-phenylethyl]-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56552713) has the molecular formula C22H21ClN2O3S and a molecular weight of 428.94 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-1-phenylethyl]-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[2-(4-chlorophenyl)-1-phenylethyl]-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56552713 |
| Molecular Formula | C22H21ClN2O3S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[2-(4-chlorophenyl)-1-phenylethyl]-2-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)NC(Cc2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21ClN2O3S/c23-19-10-6-16(7-11-19)14-21(18-4-2-1-3-5-18)25-22(26)15-17-8-12-20(13-9-17)29(24,27)28/h1-13,21H,14-15H2,(H,25,26)(H2,24,27,28) |
| InChIKey | ICRBODWWPIDHIG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |