C21H26ClNO4 — CID 156722088
(4-chlorophenyl)methanol;4-[1-(3-methylbutanoylamino)ethyl]benzoic acid (PubChem CID 156722088) has the molecular formula C21H26ClNO4 and a molecular weight of 391.90 g/mol. Its IUPAC name is (4-chlorophenyl)methanol;4-[1-(3-methylbutanoylamino)ethyl]benzoic acid.
| Compound Name | (4-chlorophenyl)methanol;4-[1-(3-methylbutanoylamino)ethyl]benzoic acid |
|---|---|
| PubChem CID | 156722088 |
| Molecular Formula | C21H26ClNO4 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (4-chlorophenyl)methanol;4-[1-(3-methylbutanoylamino)ethyl]benzoic acid |
| SMILES | CC(C)CC(=O)NC(C)c1ccc(C(=O)O)cc1.OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19NO3.C7H7ClO/c1-9(2)8-13(16)15-10(3)11-4-6-12(7-5-11)14(17)18;8-7-3-1-6(5-9)2-4-7/h4-7,9-10H,8H2,1-3H3,(H,15,16)(H,17,18);1-4,9H,5H2 |
| InChIKey | TUEKMCLHYLPOGT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |