C23H21Cl3N2O — CID 10173713
1-[3,4-bis(4-chlorophenyl)butan-2-yl]-3-(4-chlorophenyl)urea (PubChem CID 10173713) has the molecular formula C23H21Cl3N2O and a molecular weight of 447.79 g/mol. Its IUPAC name is 1-[3,4-bis(4-chlorophenyl)butan-2-yl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[3,4-bis(4-chlorophenyl)butan-2-yl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 10173713 |
| Molecular Formula | C23H21Cl3N2O |
| Molecular Weight | 447.79 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1-[3,4-bis(4-chlorophenyl)butan-2-yl]-3-(4-chlorophenyl)urea |
| SMILES | CC(NC(=O)Nc1ccc(Cl)cc1)C(Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21Cl3N2O/c1-15(27-23(29)28-21-12-10-20(26)11-13-21)22(17-4-8-19(25)9-5-17)14-16-2-6-18(24)7-3-16/h2-13,15,22H,14H2,1H3,(H2,27,28,29) |
| InChIKey | YWAIFKOZVPTDAI-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.79 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |