C23H24NO3P — CID 11784176
N-[(1S)-1-[ethoxy(phenyl)phosphoryl]-2-phenylethyl]benzamide (PubChem CID 11784176) has the molecular formula C23H24NO3P and a molecular weight of 393.42 g/mol. Its IUPAC name is N-[(1S)-1-[ethoxy(phenyl)phosphoryl]-2-phenylethyl]benzamide.
| Compound Name | N-[(1S)-1-[ethoxy(phenyl)phosphoryl]-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 11784176 |
| Molecular Formula | C23H24NO3P |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[(1S)-1-[ethoxy(phenyl)phosphoryl]-2-phenylethyl]benzamide |
| SMILES | CCOP(=O)(c1ccccc1)[C@@H](Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H24NO3P/c1-2-27-28(26,21-16-10-5-11-17-21)22(18-19-12-6-3-7-13-19)24-23(25)20-14-8-4-9-15-20/h3-17,22H,2,18H2,1H3,(H,24,25)/t22-,28?/m0/s1 |
| InChIKey | JGKCNXISPJOJHO-XYXHBKGXSA-N |
| XLogP | 4.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|