C26H30NO3P — CID 15882211
N-[1-[ethoxy(phenyl)phosphoryl]-2-(4-propan-2-ylphenyl)ethyl]benzamide (PubChem CID 15882211) has the molecular formula C26H30NO3P and a molecular weight of 435.50 g/mol. Its IUPAC name is N-[1-[ethoxy(phenyl)phosphoryl]-2-(4-propan-2-ylphenyl)ethyl]benzamide.
| Compound Name | N-[1-[ethoxy(phenyl)phosphoryl]-2-(4-propan-2-ylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 15882211 |
| Molecular Formula | C26H30NO3P |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[1-[ethoxy(phenyl)phosphoryl]-2-(4-propan-2-ylphenyl)ethyl]benzamide |
| SMILES | CCOP(=O)(c1ccccc1)C(Cc1ccc(C(C)C)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H30NO3P/c1-4-30-31(29,24-13-9-6-10-14-24)25(27-26(28)23-11-7-5-8-12-23)19-21-15-17-22(18-16-21)20(2)3/h5-18,20,25H,4,19H2,1-3H3,(H,27,28) |
| InChIKey | ZLLCJAZZORCVHG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|