C21H30NO2P — CID 101246297
1-[ethoxy(phenyl)phosphoryl]-3-methyl-N-[(1S)-1-phenylethyl]butan-1-amine (PubChem CID 101246297) has the molecular formula C21H30NO2P and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-[ethoxy(phenyl)phosphoryl]-3-methyl-N-[(1S)-1-phenylethyl]butan-1-amine.
| Compound Name | 1-[ethoxy(phenyl)phosphoryl]-3-methyl-N-[(1S)-1-phenylethyl]butan-1-amine |
|---|---|
| PubChem CID | 101246297 |
| Molecular Formula | C21H30NO2P |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[ethoxy(phenyl)phosphoryl]-3-methyl-N-[(1S)-1-phenylethyl]butan-1-amine |
| SMILES | CCOP(=O)(c1ccccc1)C(CC(C)C)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H30NO2P/c1-5-24-25(23,20-14-10-7-11-15-20)21(16-17(2)3)22-18(4)19-12-8-6-9-13-19/h6-15,17-18,21-22H,5,16H2,1-4H3/t18-,21?,25?/m0/s1 |
| InChIKey | JOJYMFGTUSNIIJ-HHIIEYADSA-N |
| XLogP | 5.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|