C16H26NO3P — CID 10781332
cis-(1S,2S)-1-diethoxyphosphoryl-2-methyl-N-[(1R)-1-phenylethyl]cyclopropan-1-amine (PubChem CID 10781332) has the molecular formula C16H26NO3P and a molecular weight of 311.36 g/mol. Its IUPAC name is cis-(1S,2S)-1-diethoxyphosphoryl-2-methyl-N-[(1R)-1-phenylethyl]cyclopropan-1-amine.
| Compound Name | cis-(1S,2S)-1-diethoxyphosphoryl-2-methyl-N-[(1R)-1-phenylethyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 10781332 |
| Molecular Formula | C16H26NO3P |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | cis-(1S,2S)-1-diethoxyphosphoryl-2-methyl-N-[(1R)-1-phenylethyl]cyclopropan-1-amine |
| SMILES | CCOP(=O)(OCC)[C@@]1(N[C@H](C)c2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C16H26NO3P/c1-5-19-21(18,20-6-2)16(12-13(16)3)17-14(4)15-10-8-7-9-11-15/h7-11,13-14,17H,5-6,12H2,1-4H3/t13-,14+,16-/m0/s1 |
| InChIKey | JZARQECEMMWEQH-LZWOXQAQSA-N |
| XLogP | 4.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|