C18H30NO3P — CID 101216353
trans-(1S,2R)-1-diethoxyphosphoryl-N-[(1S)-1-phenylethyl]-2-propan-2-ylcyclopropan-1-amine (PubChem CID 101216353) has the molecular formula C18H30NO3P and a molecular weight of 339.42 g/mol. Its IUPAC name is trans-(1S,2R)-1-diethoxyphosphoryl-N-[(1S)-1-phenylethyl]-2-propan-2-ylcyclopropan-1-amine.
| Compound Name | trans-(1S,2R)-1-diethoxyphosphoryl-N-[(1S)-1-phenylethyl]-2-propan-2-ylcyclopropan-1-amine |
|---|---|
| PubChem CID | 101216353 |
| Molecular Formula | C18H30NO3P |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | trans-(1S,2R)-1-diethoxyphosphoryl-N-[(1S)-1-phenylethyl]-2-propan-2-ylcyclopropan-1-amine |
| SMILES | CCOP(=O)(OCC)[C@@]1(N[C@@H](C)c2ccccc2)C[C@@H]1C(C)C |
| InChI | InChI=1S/C18H30NO3P/c1-6-21-23(20,22-7-2)18(13-17(18)14(3)4)19-15(5)16-11-9-8-10-12-16/h8-12,14-15,17,19H,6-7,13H2,1-5H3/t15-,17+,18-/m0/s1 |
| InChIKey | PDXBUMQLLZCNCY-JQHSSLGASA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|