C17H28NO3P — CID 102449171
2-diethoxyphosphoryl-2-methyl-1-[(1R)-1-phenylethyl]pyrrolidine (PubChem CID 102449171) has the molecular formula C17H28NO3P and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-2-methyl-1-[(1R)-1-phenylethyl]pyrrolidine.
| Compound Name | 2-diethoxyphosphoryl-2-methyl-1-[(1R)-1-phenylethyl]pyrrolidine |
|---|---|
| PubChem CID | 102449171 |
| Molecular Formula | C17H28NO3P |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-diethoxyphosphoryl-2-methyl-1-[(1R)-1-phenylethyl]pyrrolidine |
| SMILES | CCOP(=O)(OCC)C1(C)CCCN1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H28NO3P/c1-5-20-22(19,21-6-2)17(4)13-10-14-18(17)15(3)16-11-8-7-9-12-16/h7-9,11-12,15H,5-6,10,13-14H2,1-4H3/t15-,17?/m1/s1 |
| InChIKey | AFMOUTFEJXULCQ-LDCVWXEPSA-N |
| XLogP | 4.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|