C16H22F3NO3S — CID 139769243
[(2R)-2-methyl-1-(1-phenylethyl)piperidin-2-yl]methyl trifluoromethanesulfonate (PubChem CID 139769243) has the molecular formula C16H22F3NO3S and a molecular weight of 365.42 g/mol. Its IUPAC name is [(2R)-2-methyl-1-(1-phenylethyl)piperidin-2-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(2R)-2-methyl-1-(1-phenylethyl)piperidin-2-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139769243 |
| Molecular Formula | C16H22F3NO3S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | [(2R)-2-methyl-1-(1-phenylethyl)piperidin-2-yl]methyl trifluoromethanesulfonate |
| SMILES | CC(c1ccccc1)N1CCCC[C@]1(C)COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H22F3NO3S/c1-13(14-8-4-3-5-9-14)20-11-7-6-10-15(20,2)12-23-24(21,22)16(17,18)19/h3-5,8-9,13H,6-7,10-12H2,1-2H3/t13?,15-/m1/s1 |
| InChIKey | GKHIRTZIIDGYMD-AWKYBWMHSA-N |
| XLogP | 3.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|