C22H28NO4P — CID 102522932
(4R)-3-diethoxyphosphoryl-4-methyl-4-phenyl-1-[(1R)-1-phenylethyl]azetidin-2-one (PubChem CID 102522932) has the molecular formula C22H28NO4P and a molecular weight of 401.44 g/mol. Its IUPAC name is (4R)-3-diethoxyphosphoryl-4-methyl-4-phenyl-1-[(1R)-1-phenylethyl]azetidin-2-one.
| Compound Name | (4R)-3-diethoxyphosphoryl-4-methyl-4-phenyl-1-[(1R)-1-phenylethyl]azetidin-2-one |
|---|---|
| PubChem CID | 102522932 |
| Molecular Formula | C22H28NO4P |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (4R)-3-diethoxyphosphoryl-4-methyl-4-phenyl-1-[(1R)-1-phenylethyl]azetidin-2-one |
| SMILES | CCOP(=O)(OCC)C1C(=O)N([C@H](C)c2ccccc2)[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C22H28NO4P/c1-5-26-28(25,27-6-2)20-21(24)23(17(3)18-13-9-7-10-14-18)22(20,4)19-15-11-8-12-16-19/h7-17,20H,5-6H2,1-4H3/t17-,20?,22-/m1/s1 |
| InChIKey | NHGIWRFVYGTAIM-IOVLZCAISA-N |
| XLogP | 5.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|