C17H25NO3 — CID 89166679
3-ethyl-4-methyl-4-(methylperoxymethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one (PubChem CID 89166679) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-ethyl-4-methyl-4-(methylperoxymethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one.
| Compound Name | 3-ethyl-4-methyl-4-(methylperoxymethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 89166679 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3-ethyl-4-methyl-4-(methylperoxymethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one |
| SMILES | CCC1C(=O)N([C@H](C)c2ccccc2)CC1(C)COOC |
| InChI | InChI=1S/C17H25NO3/c1-5-15-16(19)18(11-17(15,3)12-21-20-4)13(2)14-9-7-6-8-10-14/h6-10,13,15H,5,11-12H2,1-4H3/t13-,15?,17?/m1/s1 |
| InChIKey | MQKNTVJIBGFKKV-BZOOQXSSSA-N |
| XLogP | 3.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|