C18H28NO4P — CID 102413285
(3R,3aS,6aR)-3-diethoxyphosphoryl-2-[(1S)-1-phenylethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazole (PubChem CID 102413285) has the molecular formula C18H28NO4P and a molecular weight of 353.40 g/mol. Its IUPAC name is (3R,3aS,6aR)-3-diethoxyphosphoryl-2-[(1S)-1-phenylethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazole.
| Compound Name | (3R,3aS,6aR)-3-diethoxyphosphoryl-2-[(1S)-1-phenylethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazole |
|---|---|
| PubChem CID | 102413285 |
| Molecular Formula | C18H28NO4P |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (3R,3aS,6aR)-3-diethoxyphosphoryl-2-[(1S)-1-phenylethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[d][1,2]oxazole |
| SMILES | CCOP(=O)(OCC)[C@@H]1[C@H]2CCC[C@H]2ON1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H28NO4P/c1-4-21-24(20,22-5-2)18-16-12-9-13-17(16)23-19(18)14(3)15-10-7-6-8-11-15/h6-8,10-11,14,16-18H,4-5,9,12-13H2,1-3H3/t14-,16-,17+,18+/m0/s1 |
| InChIKey | IRGPPAUMVKGPNT-DZJNRPSUSA-N |
| XLogP | 4.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|