C14H22NO3P — CID 134967267
2-diethoxyphosphoryl-1-phenylpyrrolidine (PubChem CID 134967267) has the molecular formula C14H22NO3P and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1-phenylpyrrolidine.
| Compound Name | 2-diethoxyphosphoryl-1-phenylpyrrolidine |
|---|---|
| PubChem CID | 134967267 |
| Molecular Formula | C14H22NO3P |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-diethoxyphosphoryl-1-phenylpyrrolidine |
| SMILES | CCOP(=O)(OCC)C1CCCN1c1ccccc1 |
| InChI | InChI=1S/C14H22NO3P/c1-3-17-19(16,18-4-2)14-11-8-12-15(14)13-9-6-5-7-10-13/h5-7,9-10,14H,3-4,8,11-12H2,1-2H3 |
| InChIKey | WENKUNWLCWSPQU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|