C20H26N3O5P — CID 102202873
5-diethoxyphosphoryl-2-phenyl-5,7,8,9,10,10a-hexahydro-[1,2,4]triazolo[1,2-a]cinnoline-1,3-dione (PubChem CID 102202873) has the molecular formula C20H26N3O5P and a molecular weight of 419.42 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-2-phenyl-5,7,8,9,10,10a-hexahydro-[1,2,4]triazolo[1,2-a]cinnoline-1,3-dione.
| Compound Name | 5-diethoxyphosphoryl-2-phenyl-5,7,8,9,10,10a-hexahydro-[1,2,4]triazolo[1,2-a]cinnoline-1,3-dione |
|---|---|
| PubChem CID | 102202873 |
| Molecular Formula | C20H26N3O5P |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 5-diethoxyphosphoryl-2-phenyl-5,7,8,9,10,10a-hexahydro-[1,2,4]triazolo[1,2-a]cinnoline-1,3-dione |
| SMILES | CCOP(=O)(OCC)C1C=C2CCCCC2n2c(=O)n(-c3ccccc3)c(=O)n21 |
| InChI | InChI=1S/C20H26N3O5P/c1-3-27-29(26,28-4-2)18-14-15-10-8-9-13-17(15)22-19(24)21(20(25)23(18)22)16-11-6-5-7-12-16/h5-7,11-12,14,17-18H,3-4,8-10,13H2,1-2H3 |
| InChIKey | ADQPIEAIESFNEQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|