C25H26N6O2 — CID 177452981
(1S,7R)-10-amino-9-benzyl-4-phenyl-2,4,6,9,11-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-10,12-diene-3,5-dione (PubChem CID 177452981) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is (1S,7R)-10-amino-9-benzyl-4-phenyl-2,4,6,9,11-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-10,12-diene-3,5-dione.
| Compound Name | (1S,7R)-10-amino-9-benzyl-4-phenyl-2,4,6,9,11-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-10,12-diene-3,5-dione |
|---|---|
| PubChem CID | 177452981 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (1S,7R)-10-amino-9-benzyl-4-phenyl-2,4,6,9,11-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-10,12-diene-3,5-dione |
| SMILES | NC1=NC2=C3CCCC[C@@H]3n3c(=O)n(-c4ccccc4)c(=O)n3[C@@H]2CN1Cc1ccccc1 |
| InChI | InChI=1S/C25H26N6O2/c26-23-27-22-19-13-7-8-14-20(19)30-24(32)29(18-11-5-2-6-12-18)25(33)31(30)21(22)16-28(23)15-17-9-3-1-4-10-17/h1-6,9-12,20-21H,7-8,13-16H2,(H2,26,27)/t20-,21+/m0/s1 |
| InChIKey | UFEJVKLWKVEDDM-LEWJYISDSA-N |
| XLogP | 2.56 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |