C19H22N6O2 — CID 177433115
(1S,7R)-10-amino-9-methyl-4-phenyl-2,4,6,9,11-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-10,12-diene-3,5-dione (PubChem CID 177433115) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is (1S,7R)-10-amino-9-methyl-4-phenyl-2,4,6,9,11-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-10,12-diene-3,5-dione.
| Compound Name | (1S,7R)-10-amino-9-methyl-4-phenyl-2,4,6,9,11-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-10,12-diene-3,5-dione |
|---|---|
| PubChem CID | 177433115 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (1S,7R)-10-amino-9-methyl-4-phenyl-2,4,6,9,11-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-10,12-diene-3,5-dione |
| SMILES | CN1C[C@@H]2C(=C3CCCC[C@@H]3n3c(=O)n(-c4ccccc4)c(=O)n32)N=C1N |
| InChI | InChI=1S/C19H22N6O2/c1-22-11-15-16(21-17(22)20)13-9-5-6-10-14(13)24-18(26)23(19(27)25(15)24)12-7-3-2-4-8-12/h2-4,7-8,14-15H,5-6,9-11H2,1H3,(H2,20,21)/t14-,15+/m0/s1 |
| InChIKey | UVQCLDTXQJXOOW-LSDHHAIUSA-N |
| XLogP | 0.98 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |