C11H11N3O3 — CID 15555687
1,3-dimethyl-5-phenyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 15555687) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 1,3-dimethyl-5-phenyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-phenyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15555687 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1,3-dimethyl-5-phenyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)n(C)c(=O)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C11H11N3O3/c1-12-9(15)13(2)11(17)14(10(12)16)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | HNZFJLVXQUZOQB-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |