C35H49N3O3 — CID 140937759
(14R)-7-(5-hydroxy-2-methylcyclohexen-1-yl)-14-methyl-13-[(2R)-6-methylheptan-2-yl]-4-phenyl-2,4,6-triazatetracyclo[7.7.0.02,6.010,14]hexadec-8-ene-3,5-dione (PubChem CID 140937759) has the molecular formula C35H49N3O3 and a molecular weight of 559.80 g/mol. Its IUPAC name is (14R)-7-(5-hydroxy-2-methylcyclohexen-1-yl)-14-methyl-13-[(2R)-6-methylheptan-2-yl]-4-phenyl-2,4,6-triazatetracyclo[7.7.0.02,6.010,14]hexadec-8-ene-3,5-dione.
| Compound Name | (14R)-7-(5-hydroxy-2-methylcyclohexen-1-yl)-14-methyl-13-[(2R)-6-methylheptan-2-yl]-4-phenyl-2,4,6-triazatetracyclo[7.7.0.02,6.010,14]hexadec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 140937759 |
| Molecular Formula | C35H49N3O3 |
| Molecular Weight | 559.80 g/mol |
| Exact Mass | 559.38 |
| IUPAC Name | (14R)-7-(5-hydroxy-2-methylcyclohexen-1-yl)-14-methyl-13-[(2R)-6-methylheptan-2-yl]-4-phenyl-2,4,6-triazatetracyclo[7.7.0.02,6.010,14]hexadec-8-ene-3,5-dione |
| SMILES | CC1=C(C2C=C3C(CC[C@@]4(C)C3CCC4[C@H](C)CCCC(C)C)n3c(=O)n(-c4ccccc4)c(=O)n32)CC(O)CC1 |
| InChI | InChI=1S/C35H49N3O3/c1-22(2)10-9-11-24(4)29-16-17-30-28-21-32(27-20-26(39)15-14-23(27)3)38-34(41)36(25-12-7-6-8-13-25)33(40)37(38)31(28)18-19-35(29,30)5/h6-8,12-13,21-22,24,26,29-32,39H,9-11,14-20H2,1-5H3/t24-,26?,29?,30?,31?,32?,35-/m1/s1 |
| InChIKey | QPGFPLZXDMZGCV-OATVFIMFSA-N |
| XLogP | 6.97 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.80 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|