C32H47NO — CID 92954774
(1R,3aS,3bR,9aR,9bR,11aR)-9a,11a-dimethyl-1-[(2S)-6-methylheptan-2-yl]-6-phenyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 92954774) has the molecular formula C32H47NO and a molecular weight of 461.73 g/mol. Its IUPAC name is (1R,3aS,3bR,9aR,9bR,11aR)-9a,11a-dimethyl-1-[(2S)-6-methylheptan-2-yl]-6-phenyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (1R,3aS,3bR,9aR,9bR,11aR)-9a,11a-dimethyl-1-[(2S)-6-methylheptan-2-yl]-6-phenyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 92954774 |
| Molecular Formula | C32H47NO |
| Molecular Weight | 461.73 g/mol |
| Exact Mass | 461.37 |
| IUPAC Name | (1R,3aS,3bR,9aR,9bR,11aR)-9a,11a-dimethyl-1-[(2S)-6-methylheptan-2-yl]-6-phenyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CC(C)CCC[C@H](C)[C@H]1CC[C@H]2[C@H]3CC=C4N(c5ccccc5)C(=O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C32H47NO/c1-22(2)10-9-11-23(3)26-15-16-27-25-14-17-29-32(5,28(25)18-20-31(26,27)4)21-19-30(34)33(29)24-12-7-6-8-13-24/h6-8,12-13,17,22-23,25-28H,9-11,14-16,18-21H2,1-5H3/t23-,25+,26+,27-,28+,31+,32+/m0/s1 |
| InChIKey | BXTWQZJDEZPOJO-NGYIHQMCSA-N |
| XLogP | 8.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.73 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |