C35H49NO2 — CID 174285267
2-[(8S,13R,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]isoindole-1,3-dione (PubChem CID 174285267) has the molecular formula C35H49NO2 and a molecular weight of 515.78 g/mol. Its IUPAC name is 2-[(8S,13R,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(8S,13R,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 174285267 |
| Molecular Formula | C35H49NO2 |
| Molecular Weight | 515.78 g/mol |
| Exact Mass | 515.38 |
| IUPAC Name | 2-[(8S,13R,14S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]isoindole-1,3-dione |
| SMILES | CC(C)CCC[C@@H](C)C1CC[C@H]2[C@@H]3CC=C4CC(N5C(=O)c6ccccc6C5=O)CCC4(C)C3CC[C@]12C |
| InChI | InChI=1S/C35H49NO2/c1-22(2)9-8-10-23(3)29-15-16-30-28-14-13-24-21-25(17-19-34(24,4)31(28)18-20-35(29,30)5)36-32(37)26-11-6-7-12-27(26)33(36)38/h6-7,11-13,22-23,25,28-31H,8-10,14-21H2,1-5H3/t23-,25?,28+,29?,30+,31?,34?,35-/m1/s1 |
| InChIKey | MLFHLKVEVMQOJF-IWDAOBNKSA-N |
| XLogP | 8.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.78 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|