C30H48N2 — CID 155530494
1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]imidazole (PubChem CID 155530494) has the molecular formula C30H48N2 and a molecular weight of 436.73 g/mol. Its IUPAC name is 1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]imidazole.
| Compound Name | 1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]imidazole |
|---|---|
| PubChem CID | 155530494 |
| Molecular Formula | C30H48N2 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.38 |
| IUPAC Name | 1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]imidazole |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](n5ccnc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H48N2/c1-21(2)7-6-8-22(3)26-11-12-27-25-10-9-23-19-24(32-18-17-31-20-32)13-15-29(23,4)28(25)14-16-30(26,27)5/h9,17-18,20-22,24-28H,6-8,10-16,19H2,1-5H3/t22-,24-,25+,26-,27+,28+,29+,30-/m1/s1 |
| InChIKey | ORVGWAWHJYCZQB-VGQLYABUSA-N |
| XLogP | 8.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|