C36H54N2 — CID 155519479
1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5,6-dimethylbenzimidazole (PubChem CID 155519479) has the molecular formula C36H54N2 and a molecular weight of 514.84 g/mol. Its IUPAC name is 1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5,6-dimethylbenzimidazole.
| Compound Name | 1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 155519479 |
| Molecular Formula | C36H54N2 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.43 |
| IUPAC Name | 1-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-5,6-dimethylbenzimidazole |
| SMILES | Cc1cc2ncn([C@@H]3CC[C@@]4(C)C(=CC[C@H]5[C@@H]6CC[C@H]([C@H](C)CCCC(C)C)[C@@]6(C)CC[C@@H]54)C3)c2cc1C |
| InChI | InChI=1S/C36H54N2/c1-23(2)9-8-10-24(3)30-13-14-31-29-12-11-27-21-28(15-17-35(27,6)32(29)16-18-36(30,31)7)38-22-37-33-19-25(4)26(5)20-34(33)38/h11,19-20,22-24,28-32H,8-10,12-18,21H2,1-7H3/t24-,28-,29+,30-,31+,32+,35+,36-/m1/s1 |
| InChIKey | LASLHSVCSMCTJR-DOHSPWMZSA-N |
| XLogP | 10.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|