C32H47ClN4 — CID 11156710
6-chloro-9-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]purine (PubChem CID 11156710) has the molecular formula C32H47ClN4 and a molecular weight of 523.21 g/mol. Its IUPAC name is 6-chloro-9-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]purine.
| Compound Name | 6-chloro-9-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]purine |
|---|---|
| PubChem CID | 11156710 |
| Molecular Formula | C32H47ClN4 |
| Molecular Weight | 523.21 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | 6-chloro-9-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]purine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](n5cnc6c(Cl)ncnc65)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H47ClN4/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-17-23(37-19-36-28-29(33)34-18-35-30(28)37)13-15-31(22,4)27(24)14-16-32(25,26)5/h9,18-21,23-27H,6-8,10-17H2,1-5H3/t21-,23-,24+,25-,26+,27+,31+,32-/m1/s1 |
| InChIKey | OWJFQOQDBYUJQI-MVXXYRMDSA-N |
| XLogP | 9.06 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.21 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|