C32H47ClN4 — CID 102206567
6-chloro-9-[(1S,2R,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-8-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]purine (PubChem CID 102206567) has the molecular formula C32H47ClN4 and a molecular weight of 523.21 g/mol. Its IUPAC name is 6-chloro-9-[(1S,2R,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-8-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]purine.
| Compound Name | 6-chloro-9-[(1S,2R,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-8-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]purine |
|---|---|
| PubChem CID | 102206567 |
| Molecular Formula | C32H47ClN4 |
| Molecular Weight | 523.21 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | 6-chloro-9-[(1S,2R,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-8-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]purine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](n4cnc5c(Cl)ncnc54)C45CC4CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H47ClN4/c1-19(2)7-6-8-20(3)23-9-10-24-22-15-26(37-18-36-27-28(33)34-17-35-29(27)37)32-16-21(32)11-14-31(32,5)25(22)12-13-30(23,24)4/h17-26H,6-16H2,1-5H3/t20-,21?,22+,23-,24+,25+,26-,30-,31-,32?/m1/s1 |
| InChIKey | XVSXZLIFBIBMFM-KUQDOJIMSA-N |
| XLogP | 8.75 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.21 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |