C33H50S — CID 102498204
(1S,2R,5R,7R,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-8-phenylsulfanylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane (PubChem CID 102498204) has the molecular formula C33H50S and a molecular weight of 478.83 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-8-phenylsulfanylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane.
| Compound Name | (1S,2R,5R,7R,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-8-phenylsulfanylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane |
|---|---|
| PubChem CID | 102498204 |
| Molecular Formula | C33H50S |
| Molecular Weight | 478.83 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | (1S,2R,5R,7R,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-8-phenylsulfanylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](Sc4ccccc4)[C@]45C[C@H]4CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H50S/c1-22(2)10-9-11-23(3)27-14-15-28-26-20-30(34-25-12-7-6-8-13-25)33-21-24(33)16-19-32(33,5)29(26)17-18-31(27,28)4/h6-8,12-13,22-24,26-30H,9-11,14-21H2,1-5H3/t23-,24-,26+,27-,28+,29+,30-,31-,32-,33+/m1/s1 |
| InChIKey | TUFVKHSHEXMHRO-RKWCTXIWSA-N |
| XLogP | 9.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.83 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |