C29H43NO — CID 169312491
2-[(3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyridine (PubChem CID 169312491) has the molecular formula C29H43NO and a molecular weight of 421.67 g/mol. Its IUPAC name is 2-[(3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyridine.
| Compound Name | 2-[(3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyridine |
|---|---|
| PubChem CID | 169312491 |
| Molecular Formula | C29H43NO |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.33 |
| IUPAC Name | 2-[(3R)-3-[(1S,2R,5R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyridine |
| SMILES | COC1C[C@H]2[C@@H]3CC[C@H]([C@H](C)CCc4ccccn4)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3CC132 |
| InChI | InChI=1S/C29H43NO/c1-19(8-9-21-7-5-6-16-30-21)23-10-11-24-22-17-26(31-4)29-18-20(29)12-15-28(29,3)25(22)13-14-27(23,24)2/h5-7,16,19-20,22-26H,8-15,17-18H2,1-4H3/t19-,20-,22+,23-,24+,25+,26?,27-,28-,29?/m1/s1 |
| InChIKey | QSUIUXORTOTSKK-WNMQKZKYSA-N |
| XLogP | 6.93 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |