C30H42N2O — CID 169257226
2-[(3R)-3-[(1S,2R,5R,7S,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyridine-3-carbonitrile (PubChem CID 169257226) has the molecular formula C30H42N2O and a molecular weight of 446.68 g/mol. Its IUPAC name is 2-[(3R)-3-[(1S,2R,5R,7S,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyridine-3-carbonitrile.
| Compound Name | 2-[(3R)-3-[(1S,2R,5R,7S,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 169257226 |
| Molecular Formula | C30H42N2O |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | 2-[(3R)-3-[(1S,2R,5R,7S,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyridine-3-carbonitrile |
| SMILES | COC1C[C@H]2[C@@H]3CC[C@H]([C@H](C)CCc4ncccc4C#N)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3C[C@]132 |
| InChI | InChI=1S/C30H42N2O/c1-19(7-10-26-20(18-31)6-5-15-32-26)23-8-9-24-22-16-27(33-4)30-17-21(30)11-14-29(30,3)25(22)12-13-28(23,24)2/h5-6,15,19,21-25,27H,7-14,16-17H2,1-4H3/t19-,21-,22+,23-,24+,25+,27?,28-,29-,30-/m1/s1 |
| InChIKey | ZETVVMQJAXQKGQ-HGIAXEIKSA-N |
| XLogP | 6.81 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |