C25H40O3 — CID 66861137
(4R)-4-[(1S,2R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pentanoic acid (PubChem CID 66861137) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is (4R)-4-[(1S,2R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pentanoic acid.
| Compound Name | (4R)-4-[(1S,2R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pentanoic acid |
|---|---|
| PubChem CID | 66861137 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (4R)-4-[(1S,2R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]pentanoic acid |
| SMILES | COC1C[C@H]2[C@@H]3CC[C@H]([C@H](C)CCC(=O)O)[C@@]3(C)CC[C@@H]2[C@@]2(C)CCC3CC312 |
| InChI | InChI=1S/C25H40O3/c1-15(5-8-22(26)27)18-6-7-19-17-13-21(28-4)25-14-16(25)9-12-24(25,3)20(17)10-11-23(18,19)2/h15-21H,5-14H2,1-4H3,(H,26,27)/t15-,16?,17+,18-,19+,20+,21?,23-,24-,25?/m1/s1 |
| InChIKey | IGMIULWMUJBBCI-VKNWFJBJSA-N |
| XLogP | 5.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |