C28H48O3 — CID 22797857
(3R,6R)-6-[(1S,2R,5S,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2-methylheptane-2,3-diol (PubChem CID 22797857) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is (3R,6R)-6-[(1S,2R,5S,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2-methylheptane-2,3-diol.
| Compound Name | (3R,6R)-6-[(1S,2R,5S,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2-methylheptane-2,3-diol |
|---|---|
| PubChem CID | 22797857 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | (3R,6R)-6-[(1S,2R,5S,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-2-methylheptane-2,3-diol |
| SMILES | CO[C@@H]1C[C@H]2[C@@H]3CC[C@H]([C@H](C)CC[C@@H](O)C(C)(C)O)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@H]3C[C@]312 |
| InChI | InChI=1S/C28H48O3/c1-17(7-10-23(29)25(2,3)30)20-8-9-21-19-15-24(31-6)28-16-18(28)11-14-27(28,5)22(19)12-13-26(20,21)4/h17-24,29-30H,7-16H2,1-6H3/t17-,18+,19+,20-,21+,22+,23-,24-,26-,27-,28+/m1/s1 |
| InChIKey | QJXFABBATQJESO-UDLDQEGJSA-N |
| XLogP | 5.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |