C30H48O — CID 25087810
(1S,2R,5R,7R,8R,10S,11S,14R,15R)-14-[(2R)-1-[(1S,3R)-3-ethenyl-2,2-dimethylcyclopropyl]propan-2-yl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane (PubChem CID 25087810) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,10S,11S,14R,15R)-14-[(2R)-1-[(1S,3R)-3-ethenyl-2,2-dimethylcyclopropyl]propan-2-yl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane.
| Compound Name | (1S,2R,5R,7R,8R,10S,11S,14R,15R)-14-[(2R)-1-[(1S,3R)-3-ethenyl-2,2-dimethylcyclopropyl]propan-2-yl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane |
|---|---|
| PubChem CID | 25087810 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | (1S,2R,5R,7R,8R,10S,11S,14R,15R)-14-[(2R)-1-[(1S,3R)-3-ethenyl-2,2-dimethylcyclopropyl]propan-2-yl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane |
| SMILES | C=C[C@@H]1[C@H](C[C@@H](C)[C@H]2CC[C@H]3[C@@H]4C[C@@H](OC)[C@]56C[C@H]5CC[C@]6(C)[C@H]4CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C30H48O/c1-8-21-25(27(21,3)4)15-18(2)22-9-10-23-20-16-26(31-7)30-17-19(30)11-14-29(30,6)24(20)12-13-28(22,23)5/h8,18-26H,1,9-17H2,2-7H3/t18-,19-,20+,21-,22-,23+,24+,25+,26-,28-,29-,30+/m1/s1 |
| InChIKey | OGWXBOHZOJMVSM-MHRSQGOESA-N |
| XLogP | 7.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|