C30H49BrO — CID 25089479
(1S,2R,5R,7R,8R,10S,11S,14R,15R)-14-[(2R)-1-[(1S,2S,3R)-2-bromo-2-methyl-3-propan-2-ylcyclopropyl]propan-2-yl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane (PubChem CID 25089479) has the molecular formula C30H49BrO and a molecular weight of 505.63 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,10S,11S,14R,15R)-14-[(2R)-1-[(1S,2S,3R)-2-bromo-2-methyl-3-propan-2-ylcyclopropyl]propan-2-yl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane.
| Compound Name | (1S,2R,5R,7R,8R,10S,11S,14R,15R)-14-[(2R)-1-[(1S,2S,3R)-2-bromo-2-methyl-3-propan-2-ylcyclopropyl]propan-2-yl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane |
|---|---|
| PubChem CID | 25089479 |
| Molecular Formula | C30H49BrO |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | (1S,2R,5R,7R,8R,10S,11S,14R,15R)-14-[(2R)-1-[(1S,2S,3R)-2-bromo-2-methyl-3-propan-2-ylcyclopropyl]propan-2-yl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecane |
| SMILES | CO[C@@H]1C[C@H]2[C@@H]3CC[C@H]([C@H](C)C[C@H]4[C@@H](C(C)C)[C@@]4(C)Br)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3C[C@]312 |
| InChI | InChI=1S/C30H49BrO/c1-17(2)26-24(29(26,6)31)14-18(3)21-8-9-22-20-15-25(32-7)30-16-19(30)10-13-28(30,5)23(20)11-12-27(21,22)4/h17-26H,8-16H2,1-7H3/t18-,19-,20+,21-,22+,23+,24+,25-,26-,27-,28-,29+,30+/m1/s1 |
| InChIKey | VDWUWBIKUKKBLP-AMOOFQIXSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|