C29H46O2 — CID 25087808
trans-(1S,3S)-3-[(2R)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]propyl]-2,2-dimethylcyclopropane-1-carbaldehyde (PubChem CID 25087808) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is trans-(1S,3S)-3-[(2R)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]propyl]-2,2-dimethylcyclopropane-1-carbaldehyde.
| Compound Name | trans-(1S,3S)-3-[(2R)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]propyl]-2,2-dimethylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 25087808 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | trans-(1S,3S)-3-[(2R)-2-[(1S,2R,5R,7R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]propyl]-2,2-dimethylcyclopropane-1-carbaldehyde |
| SMILES | CO[C@@H]1C[C@H]2[C@@H]3CC[C@H]([C@H](C)C[C@H]4[C@H](C=O)C4(C)C)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3C[C@]312 |
| InChI | InChI=1S/C29H46O2/c1-17(13-23-24(16-30)26(23,2)3)20-7-8-21-19-14-25(31-6)29-15-18(29)9-12-28(29,5)22(19)10-11-27(20,21)4/h16-25H,7-15H2,1-6H3/t17-,18-,19+,20-,21+,22+,23+,24+,25-,27-,28-,29+/m1/s1 |
| InChIKey | KOBBSICGBFAPJH-BOOVGGIDSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|