C28H42N2O — CID 169312505
5-[(3R)-3-[(1S,2R,5R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyrimidine (PubChem CID 169312505) has the molecular formula C28H42N2O and a molecular weight of 422.66 g/mol. Its IUPAC name is 5-[(3R)-3-[(1S,2R,5R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyrimidine.
| Compound Name | 5-[(3R)-3-[(1S,2R,5R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyrimidine |
|---|---|
| PubChem CID | 169312505 |
| Molecular Formula | C28H42N2O |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | 5-[(3R)-3-[(1S,2R,5R,8R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]pyrimidine |
| SMILES | CO[C@@H]1C[C@H]2[C@@H]3CC[C@H]([C@H](C)CCc4cncnc4)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3CC312 |
| InChI | InChI=1S/C28H42N2O/c1-18(5-6-19-15-29-17-30-16-19)22-7-8-23-21-13-25(31-4)28-14-20(28)9-12-27(28,3)24(21)10-11-26(22,23)2/h15-18,20-25H,5-14H2,1-4H3/t18-,20-,21+,22-,23+,24+,25-,26-,27-,28?/m1/s1 |
| InChIKey | CXKRRGRFDGEBCH-LNVSDIKXSA-N |
| XLogP | 6.33 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |