C30H45NO2 — CID 170306201
[2-[3-[(1S,2R,5R,7R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]-3-pyridinyl]methanol (PubChem CID 170306201) has the molecular formula C30H45NO2 and a molecular weight of 451.70 g/mol. Its IUPAC name is [2-[3-[(1S,2R,5R,7R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]-3-pyridinyl]methanol.
| Compound Name | [2-[3-[(1S,2R,5R,7R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 170306201 |
| Molecular Formula | C30H45NO2 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.35 |
| IUPAC Name | [2-[3-[(1S,2R,5R,7R,10S,11S,14R,15R)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]butyl]-3-pyridinyl]methanol |
| SMILES | COC1C[C@H]2[C@@H]3CC[C@H](C(C)CCc4ncccc4CO)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3C[C@@]132 |
| InChI | InChI=1S/C30H45NO2/c1-19(7-10-26-20(18-32)6-5-15-31-26)23-8-9-24-22-16-27(33-4)30-17-21(30)11-14-29(30,3)25(22)12-13-28(23,24)2/h5-6,15,19,21-25,27,32H,7-14,16-18H2,1-4H3/t19?,21-,22+,23-,24+,25+,27?,28-,29-,30+/m1/s1 |
| InChIKey | IZAIDPHXCSEDOG-VZIIFOPGSA-N |
| XLogP | 6.43 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |