C29H47BrO2 — CID 125030923
[(1R,2R,5R,7R,8S,10S,11R,14S,15R)-2,15-dimethyl-14-[(2S)-6-methylheptan-2-yl]-8-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl] 2-bromoacetate (PubChem CID 125030923) has the molecular formula C29H47BrO2 and a molecular weight of 507.60 g/mol. Its IUPAC name is [(1R,2R,5R,7R,8S,10S,11R,14S,15R)-2,15-dimethyl-14-[(2S)-6-methylheptan-2-yl]-8-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl] 2-bromoacetate.
| Compound Name | [(1R,2R,5R,7R,8S,10S,11R,14S,15R)-2,15-dimethyl-14-[(2S)-6-methylheptan-2-yl]-8-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl] 2-bromoacetate |
|---|---|
| PubChem CID | 125030923 |
| Molecular Formula | C29H47BrO2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | [(1R,2R,5R,7R,8S,10S,11R,14S,15R)-2,15-dimethyl-14-[(2S)-6-methylheptan-2-yl]-8-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl] 2-bromoacetate |
| SMILES | CC(C)CCC[C@H](C)[C@@H]1CC[C@@H]2[C@@H]3C[C@H](OC(=O)CBr)[C@]45C[C@H]4CC[C@]5(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C29H47BrO2/c1-18(2)7-6-8-19(3)22-9-10-23-21-15-25(32-26(31)17-30)29-16-20(29)11-14-28(29,5)24(21)12-13-27(22,23)4/h18-25H,6-17H2,1-5H3/t19-,20+,21-,22-,23+,24+,25-,27+,28+,29-/m0/s1 |
| InChIKey | KHVIWBCFNVESQF-QZHINXAGSA-N |
| XLogP | 8.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|