C38H56N2O2 — CID 70882807
2-[3-[[(3S,10R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]propyl]isoindole-1,3-dione (PubChem CID 70882807) has the molecular formula C38H56N2O2 and a molecular weight of 572.88 g/mol. Its IUPAC name is 2-[3-[[(3S,10R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[[(3S,10R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70882807 |
| Molecular Formula | C38H56N2O2 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.43 |
| IUPAC Name | 2-[3-[[(3S,10R,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]amino]propyl]isoindole-1,3-dione |
| SMILES | CC(C)CCCC(C)[C@H]1CCC2C3CC=C4C[C@@H](NCCCN5C(=O)c6ccccc6C5=O)CC[C@]4(C)C3CCC21C |
| InChI | InChI=1S/C38H56N2O2/c1-25(2)10-8-11-26(3)32-16-17-33-31-15-14-27-24-28(18-20-37(27,4)34(31)19-21-38(32,33)5)39-22-9-23-40-35(41)29-12-6-7-13-30(29)36(40)42/h6-7,12-14,25-26,28,31-34,39H,8-11,15-24H2,1-5H3/t26?,28-,31?,32+,33?,34?,37-,38?/m0/s1 |
| InChIKey | DXRFMROVZYUBNF-HDFQBDKZSA-N |
| XLogP | 8.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|